C7H17N3O4S2 — CID 82842401
2-methyl-2-(methylsulfonylmethylsulfonylamino)butanimidamide (PubChem CID 82842401) has the molecular formula C7H17N3O4S2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-methyl-2-(methylsulfonylmethylsulfonylamino)butanimidamide.
| Compound Name | 2-methyl-2-(methylsulfonylmethylsulfonylamino)butanimidamide |
|---|---|
| PubChem CID | 82842401 |
| Molecular Formula | C7H17N3O4S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-methyl-2-(methylsulfonylmethylsulfonylamino)butanimidamide |
| SMILES | [H]/N=C(\N)C(C)(CC)NS(=O)(=O)CS(C)(=O)=O |
| InChI | InChI=1S/C7H17N3O4S2/c1-4-7(2,6(8)9)10-16(13,14)5-15(3,11)12/h10H,4-5H2,1-3H3,(H3,8,9) |
| InChIKey | COQDCHKTYRWIDZ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 130.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|