C9H20N2O2S2 — CID 61124679
2-(butylsulfonylamino)-2-methylbutanethioamide (PubChem CID 61124679) has the molecular formula C9H20N2O2S2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-(butylsulfonylamino)-2-methylbutanethioamide.
| Compound Name | 2-(butylsulfonylamino)-2-methylbutanethioamide |
|---|---|
| PubChem CID | 61124679 |
| Molecular Formula | C9H20N2O2S2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-(butylsulfonylamino)-2-methylbutanethioamide |
| SMILES | CCCCS(=O)(=O)NC(C)(CC)C(N)=S |
| InChI | InChI=1S/C9H20N2O2S2/c1-4-6-7-15(12,13)11-9(3,5-2)8(10)14/h11H,4-7H2,1-3H3,(H2,10,14) |
| InChIKey | FYICOVQYZCTFOI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|