C10H20N2O4S2 — CID 54952425
methyl 4-[(1-amino-2-methyl-1-sulfanylidenebutan-2-yl)sulfamoyl]butanoate (PubChem CID 54952425) has the molecular formula C10H20N2O4S2 and a molecular weight of 296.41 g/mol. Its IUPAC name is methyl 4-[(1-amino-2-methyl-1-sulfanylidenebutan-2-yl)sulfamoyl]butanoate.
| Compound Name | methyl 4-[(1-amino-2-methyl-1-sulfanylidenebutan-2-yl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 54952425 |
| Molecular Formula | C10H20N2O4S2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | methyl 4-[(1-amino-2-methyl-1-sulfanylidenebutan-2-yl)sulfamoyl]butanoate |
| SMILES | CCC(C)(NS(=O)(=O)CCCC(=O)OC)C(N)=S |
| InChI | InChI=1S/C10H20N2O4S2/c1-4-10(2,9(11)17)12-18(14,15)7-5-6-8(13)16-3/h12H,4-7H2,1-3H3,(H2,11,17) |
| InChIKey | NAQACGIWWWYMST-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|