methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate

C7H12F3NO4S — CID 61460318

IUPACmethyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate
SMILESCOC(=O)CCCS(=O)(=O)NCC(F)(F)F
InChIInChI=1S/C7H12F3NO4S/c1-15-6(12)3-2-4-16(13,14)11-5-7(8,9)10/h11H,2-5H2,1H3
InChIKeyNNNXBWKDJNQHHZ-UHFFFAOYSA-N
MW263.24 g/mol
LogP0.42
Rot. Bonds6

About methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate

methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate (PubChem CID 61460318) has the molecular formula C7H12F3NO4S and a molecular weight of 263.24 g/mol. Its IUPAC name is methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate.

Molecular Properties

Compound Namemethyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate
PubChem CID61460318
Molecular FormulaC7H12F3NO4S
Molecular Weight263.24 g/mol
Exact Mass263.04
IUPAC Namemethyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate
SMILESCOC(=O)CCCS(=O)(=O)NCC(F)(F)F
InChIInChI=1S/C7H12F3NO4S/c1-15-6(12)3-2-4-16(13,14)11-5-7(8,9)10/h11H,2-5H2,1H3
InChIKeyNNNXBWKDJNQHHZ-UHFFFAOYSA-N
XLogP0.42
TPSA72.47 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500263.24
LogP ≤ 50.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate?
The IUPAC name of methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate (CID 61460318) is methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate.
What is the SMILES notation for methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate?
The canonical SMILES for methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate is COC(=O)CCCS(=O)(=O)NCC(F)(F)F.
What is the InChIKey of methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate?
The InChIKey is NNNXBWKDJNQHHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F3NO4S/c1-15-6(12)3-2-4-16(13,14)11-5-7(8,9)10/h11H,2-5H2,1H3.
What are the key properties of methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate?
methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate has a molecular weight of 263.24 g/mol, XLogP of 0.42, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate is sourced from PubChem (CID 61460318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).