C7H12F3NO4S — CID 61460318
methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate (PubChem CID 61460318) has the molecular formula C7H12F3NO4S and a molecular weight of 263.24 g/mol. Its IUPAC name is methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate.
| Compound Name | methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate |
|---|---|
| PubChem CID | 61460318 |
| Molecular Formula | C7H12F3NO4S |
| Molecular Weight | 263.24 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | methyl 4-(2,2,2-trifluoroethylsulfamoyl)butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H12F3NO4S/c1-15-6(12)3-2-4-16(13,14)11-5-7(8,9)10/h11H,2-5H2,1H3 |
| InChIKey | NNNXBWKDJNQHHZ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |