C10H19NO7S — CID 66002556
3-hydroxy-4-[(4-methoxy-4-oxobutyl)sulfonylamino]-3-methylbutanoic acid (PubChem CID 66002556) has the molecular formula C10H19NO7S and a molecular weight of 297.33 g/mol. Its IUPAC name is 3-hydroxy-4-[(4-methoxy-4-oxobutyl)sulfonylamino]-3-methylbutanoic acid.
| Compound Name | 3-hydroxy-4-[(4-methoxy-4-oxobutyl)sulfonylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66002556 |
| Molecular Formula | C10H19NO7S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-hydroxy-4-[(4-methoxy-4-oxobutyl)sulfonylamino]-3-methylbutanoic acid |
| SMILES | COC(=O)CCCS(=O)(=O)NCC(C)(O)CC(=O)O |
| InChI | InChI=1S/C10H19NO7S/c1-10(15,6-8(12)13)7-11-19(16,17)5-3-4-9(14)18-2/h11,15H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | QIZBQTUPYYYMCN-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |