C6H13NO5S — CID 66003148
3-hydroxy-4-(methanesulfonamido)-3-methylbutanoic acid (PubChem CID 66003148) has the molecular formula C6H13NO5S and a molecular weight of 211.24 g/mol. Its IUPAC name is 3-hydroxy-4-(methanesulfonamido)-3-methylbutanoic acid.
| Compound Name | 3-hydroxy-4-(methanesulfonamido)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66003148 |
| Molecular Formula | C6H13NO5S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 3-hydroxy-4-(methanesulfonamido)-3-methylbutanoic acid |
| SMILES | CC(O)(CNS(C)(=O)=O)CC(=O)O |
| InChI | InChI=1S/C6H13NO5S/c1-6(10,3-5(8)9)4-7-13(2,11)12/h7,10H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | LBRQSUINTHOUKA-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |