C9H16N2O5S — CID 66002550
4-(1-cyanopropylsulfonylamino)-3-hydroxy-3-methylbutanoic acid (PubChem CID 66002550) has the molecular formula C9H16N2O5S and a molecular weight of 264.30 g/mol. Its IUPAC name is 4-(1-cyanopropylsulfonylamino)-3-hydroxy-3-methylbutanoic acid.
| Compound Name | 4-(1-cyanopropylsulfonylamino)-3-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 66002550 |
| Molecular Formula | C9H16N2O5S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 4-(1-cyanopropylsulfonylamino)-3-hydroxy-3-methylbutanoic acid |
| SMILES | CCC(C#N)S(=O)(=O)NCC(C)(O)CC(=O)O |
| InChI | InChI=1S/C9H16N2O5S/c1-3-7(5-10)17(15,16)11-6-9(2,14)4-8(12)13/h7,11,14H,3-4,6H2,1-2H3,(H,12,13) |
| InChIKey | SVQBJSLNGUAEAZ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 127.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |