C11H14N2O3S — CID 113338253
1-cyano-N-[(2-hydroxyphenyl)methyl]propane-1-sulfonamide (PubChem CID 113338253) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is 1-cyano-N-[(2-hydroxyphenyl)methyl]propane-1-sulfonamide.
| Compound Name | 1-cyano-N-[(2-hydroxyphenyl)methyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 113338253 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 1-cyano-N-[(2-hydroxyphenyl)methyl]propane-1-sulfonamide |
| SMILES | CCC(C#N)S(=O)(=O)NCc1ccccc1O |
| InChI | InChI=1S/C11H14N2O3S/c1-2-10(7-12)17(15,16)13-8-9-5-3-4-6-11(9)14/h3-6,10,13-14H,2,8H2,1H3 |
| InChIKey | MDLURHRQULQYIS-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|