About 2-ethylphenol;N-methylmethanamine
2-ethylphenol;N-methylmethanamine (PubChem CID 118325670) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-ethylphenol;N-methylmethanamine.
Molecular Properties
| Compound Name | 2-ethylphenol;N-methylmethanamine |
| PubChem CID | 118325670 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-ethylphenol;N-methylmethanamine |
| SMILES | CCc1ccccc1O.CNC |
| InChI | InChI=1S/C8H10O.C2H7N/c1-2-7-5-3-4-6-8(7)9;1-3-2/h3-6,9H,2H2,1H3;3H,1-2H3 |
| InChIKey | MTBNKKZPARIPEY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylphenol;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylphenol;N-methylmethanamine?
The IUPAC name of 2-ethylphenol;N-methylmethanamine (CID 118325670) is 2-ethylphenol;N-methylmethanamine.
What is the SMILES notation for 2-ethylphenol;N-methylmethanamine?
The canonical SMILES for 2-ethylphenol;N-methylmethanamine is CCc1ccccc1O.CNC.
What is the InChIKey of 2-ethylphenol;N-methylmethanamine?
The InChIKey is MTBNKKZPARIPEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C2H7N/c1-2-7-5-3-4-6-8(7)9;1-3-2/h3-6,9H,2H2,1H3;3H,1-2H3.
What are the key properties of 2-ethylphenol;N-methylmethanamine?
2-ethylphenol;N-methylmethanamine has a molecular weight of 167.25 g/mol, XLogP of 1.79, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylphenol;N-methylmethanamine is sourced from PubChem (CID 118325670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).