About 2-ethylphenol;isocyanic acid
2-ethylphenol;isocyanic acid (PubChem CID 172820401) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-ethylphenol;isocyanic acid.
Molecular Properties
| Compound Name | 2-ethylphenol;isocyanic acid |
| PubChem CID | 172820401 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-ethylphenol;isocyanic acid |
| SMILES | CCc1ccccc1O.N=C=O.N=C=O |
| InChI | InChI=1S/C8H10O.2CHNO/c1-2-7-5-3-4-6-8(7)9;2*2-1-3/h3-6,9H,2H2,1H3;2*2H |
| InChIKey | UDNQRJXJBYKVKI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylphenol;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylphenol;isocyanic acid?
The IUPAC name of 2-ethylphenol;isocyanic acid (CID 172820401) is 2-ethylphenol;isocyanic acid.
What is the SMILES notation for 2-ethylphenol;isocyanic acid?
The canonical SMILES for 2-ethylphenol;isocyanic acid is CCc1ccccc1O.N=C=O.N=C=O.
What is the InChIKey of 2-ethylphenol;isocyanic acid?
The InChIKey is UDNQRJXJBYKVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.2CHNO/c1-2-7-5-3-4-6-8(7)9;2*2-1-3/h3-6,9H,2H2,1H3;2*2H.
What are the key properties of 2-ethylphenol;isocyanic acid?
2-ethylphenol;isocyanic acid has a molecular weight of 208.22 g/mol, XLogP of 1.76, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylphenol;isocyanic acid is sourced from PubChem (CID 172820401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).