C12H21NO4 — CID 67532608
2-amino-2-(hydroxymethyl)propane-1,3-diol;2-ethylphenol (PubChem CID 67532608) has the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-ethylphenol.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-ethylphenol |
|---|---|
| PubChem CID | 67532608 |
| Molecular Formula | C12H21NO4 |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-ethylphenol |
| SMILES | CCc1ccccc1O.NC(CO)(CO)CO |
| InChI | InChI=1S/C8H10O.C4H11NO3/c1-2-7-5-3-4-6-8(7)9;5-4(1-6,2-7)3-8/h3-6,9H,2H2,1H3;6-8H,1-3,5H2 |
| InChIKey | IVSKRAQGBJABPQ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |