C16H20O — CID 174948528
2-ethylphenol;1,3-xylene (PubChem CID 174948528) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-ethylphenol;1,3-xylene.
| Compound Name | 2-ethylphenol;1,3-xylene |
|---|---|
| PubChem CID | 174948528 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-ethylphenol;1,3-xylene |
| SMILES | CCc1ccccc1O.Cc1cccc(C)c1 |
| InChI | InChI=1S/C8H10O.C8H10/c1-2-7-5-3-4-6-8(7)9;1-7-4-3-5-8(2)6-7/h3-6,9H,2H2,1H3;3-6H,1-2H3 |
| InChIKey | PTKNZEVYNMBYBQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |