About 2-ethylphenol;formaldehyde;urea
2-ethylphenol;formaldehyde;urea (PubChem CID 162140280) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-ethylphenol;formaldehyde;urea.
Molecular Properties
| Compound Name | 2-ethylphenol;formaldehyde;urea |
| PubChem CID | 162140280 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-ethylphenol;formaldehyde;urea |
| SMILES | C=O.CCc1ccccc1O.NC(N)=O |
| InChI | InChI=1S/C8H10O.CH4N2O.CH2O/c1-2-7-5-3-4-6-8(7)9;2-1(3)4;1-2/h3-6,9H,2H2,1H3;(H4,2,3,4);1H2 |
| InChIKey | ZJVJFVKHACYXFH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethylphenol;formaldehyde;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylphenol;formaldehyde;urea?
The IUPAC name of 2-ethylphenol;formaldehyde;urea (CID 162140280) is 2-ethylphenol;formaldehyde;urea.
What is the SMILES notation for 2-ethylphenol;formaldehyde;urea?
The canonical SMILES for 2-ethylphenol;formaldehyde;urea is C=O.CCc1ccccc1O.NC(N)=O.
What is the InChIKey of 2-ethylphenol;formaldehyde;urea?
The InChIKey is ZJVJFVKHACYXFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.CH4N2O.CH2O/c1-2-7-5-3-4-6-8(7)9;2-1(3)4;1-2/h3-6,9H,2H2,1H3;(H4,2,3,4);1H2.
What are the key properties of 2-ethylphenol;formaldehyde;urea?
2-ethylphenol;formaldehyde;urea has a molecular weight of 212.25 g/mol, XLogP of 0.79, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylphenol;formaldehyde;urea is sourced from PubChem (CID 162140280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).