About formaldehyde;2-(hydroxymethyl)phenol
formaldehyde;2-(hydroxymethyl)phenol (PubChem CID 69155710) has the molecular formula C8H10O3
and a molecular weight of 154.16 g/mol. Its IUPAC name is formaldehyde;2-(hydroxymethyl)phenol.
Molecular Properties
| Compound Name | formaldehyde;2-(hydroxymethyl)phenol |
| PubChem CID | 69155710 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | formaldehyde;2-(hydroxymethyl)phenol |
| SMILES | C=O.OCc1ccccc1O |
| InChI | InChI=1S/C7H8O2.CH2O/c8-5-6-3-1-2-4-7(6)9;1-2/h1-4,8-9H,5H2;1H2 |
| InChIKey | SDPFNAZQUMPARM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formaldehyde;2-(hydroxymethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-(hydroxymethyl)phenol?
The IUPAC name of formaldehyde;2-(hydroxymethyl)phenol (CID 69155710) is formaldehyde;2-(hydroxymethyl)phenol.
What is the SMILES notation for formaldehyde;2-(hydroxymethyl)phenol?
The canonical SMILES for formaldehyde;2-(hydroxymethyl)phenol is C=O.OCc1ccccc1O.
What is the InChIKey of formaldehyde;2-(hydroxymethyl)phenol?
The InChIKey is SDPFNAZQUMPARM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.CH2O/c8-5-6-3-1-2-4-7(6)9;1-2/h1-4,8-9H,5H2;1H2.
What are the key properties of formaldehyde;2-(hydroxymethyl)phenol?
formaldehyde;2-(hydroxymethyl)phenol has a molecular weight of 154.16 g/mol, XLogP of 0.70, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-(hydroxymethyl)phenol is sourced from PubChem (CID 69155710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).