About CID 137424646
CID 137424646 (PubChem CID 137424646) has the molecular formula C7H8NaO2
and a molecular weight of 147.13 g/mol.
Molecular Properties
| Compound Name | CID 137424646 |
| PubChem CID | 137424646 |
| Molecular Formula | C7H8NaO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | — |
| SMILES | OCc1ccccc1O.[Na] |
| InChI | InChI=1S/C7H8O2.Na/c8-5-6-3-1-2-4-7(6)9;/h1-4,8-9H,5H2; |
| InChIKey | DCWHJAIDYVBFIL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 137424646 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137424646?
The IUPAC name of CID 137424646 (CID 137424646) is not available.
What is the SMILES notation for CID 137424646?
The canonical SMILES for CID 137424646 is OCc1ccccc1O.[Na].
What is the InChIKey of CID 137424646?
The InChIKey is DCWHJAIDYVBFIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.Na/c8-5-6-3-1-2-4-7(6)9;/h1-4,8-9H,5H2;.
What are the key properties of CID 137424646?
CID 137424646 has a molecular weight of 147.13 g/mol, XLogP of 0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137424646 is sourced from PubChem (CID 137424646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).