About 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid)
2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid) (PubChem CID 118271940) has the molecular formula C17H26N2O6
and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid).
Molecular Properties
| Compound Name | 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid) |
| PubChem CID | 118271940 |
| Molecular Formula | C17H26N2O6 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid) |
| SMILES | O=C(O)N1CCCC1.O=C(O)N1CCCC1.OCc1ccccc1O |
| InChI | InChI=1S/C7H8O2.2C5H9NO2/c8-5-6-3-1-2-4-7(6)9;2*7-5(8)6-3-1-2-4-6/h1-4,8-9H,5H2;2*1-4H2,(H,7,8) |
| InChIKey | FILOZADPWBDZHC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid)?
The IUPAC name of 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid) (CID 118271940) is 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid).
What is the SMILES notation for 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid)?
The canonical SMILES for 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid) is O=C(O)N1CCCC1.O=C(O)N1CCCC1.OCc1ccccc1O.
What is the InChIKey of 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid)?
The InChIKey is FILOZADPWBDZHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.2C5H9NO2/c8-5-6-3-1-2-4-7(6)9;2*7-5(8)6-3-1-2-4-6/h1-4,8-9H,5H2;2*1-4H2,(H,7,8).
What are the key properties of 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid)?
2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid) has a molecular weight of 354.40 g/mol, XLogP of 2.40, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)phenol;bis(pyrrolidine-1-carboxylic acid) is sourced from PubChem (CID 118271940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).