C22H20O4 — CID 68756440
3,3-diphenylprop-2-enoic acid;2-(hydroxymethyl)phenol (PubChem CID 68756440) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3,3-diphenylprop-2-enoic acid;2-(hydroxymethyl)phenol.
| Compound Name | 3,3-diphenylprop-2-enoic acid;2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 68756440 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3,3-diphenylprop-2-enoic acid;2-(hydroxymethyl)phenol |
| SMILES | O=C(O)C=C(c1ccccc1)c1ccccc1.OCc1ccccc1O |
| InChI | InChI=1S/C15H12O2.C7H8O2/c16-15(17)11-14(12-7-3-1-4-8-12)13-9-5-2-6-10-13;8-5-6-3-1-2-4-7(6)9/h1-11H,(H,16,17);1-4,8-9H,5H2 |
| InChIKey | DLWMMDGHSJYIAH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|