About cyclohexane;2-(hydroxymethyl)phenol
cyclohexane;2-(hydroxymethyl)phenol (PubChem CID 174697635) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is cyclohexane;2-(hydroxymethyl)phenol.
Molecular Properties
| Compound Name | cyclohexane;2-(hydroxymethyl)phenol |
| PubChem CID | 174697635 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | cyclohexane;2-(hydroxymethyl)phenol |
| SMILES | C1CCCCC1.OCc1ccccc1O |
| InChI | InChI=1S/C7H8O2.C6H12/c8-5-6-3-1-2-4-7(6)9;1-2-4-6-5-3-1/h1-4,8-9H,5H2;1-6H2 |
| InChIKey | QANWDPJMRWMGBR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexane;2-(hydroxymethyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;2-(hydroxymethyl)phenol?
The IUPAC name of cyclohexane;2-(hydroxymethyl)phenol (CID 174697635) is cyclohexane;2-(hydroxymethyl)phenol.
What is the SMILES notation for cyclohexane;2-(hydroxymethyl)phenol?
The canonical SMILES for cyclohexane;2-(hydroxymethyl)phenol is C1CCCCC1.OCc1ccccc1O.
What is the InChIKey of cyclohexane;2-(hydroxymethyl)phenol?
The InChIKey is QANWDPJMRWMGBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.C6H12/c8-5-6-3-1-2-4-7(6)9;1-2-4-6-5-3-1/h1-4,8-9H,5H2;1-6H2.
What are the key properties of cyclohexane;2-(hydroxymethyl)phenol?
cyclohexane;2-(hydroxymethyl)phenol has a molecular weight of 208.30 g/mol, XLogP of 3.23, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;2-(hydroxymethyl)phenol is sourced from PubChem (CID 174697635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).