About benzene-1,2-diol;cyclohexane
benzene-1,2-diol;cyclohexane (PubChem CID 175415805) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is benzene-1,2-diol;cyclohexane.
Molecular Properties
| Compound Name | benzene-1,2-diol;cyclohexane |
| PubChem CID | 175415805 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | benzene-1,2-diol;cyclohexane |
| SMILES | C1CCCCC1.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.C6H12/c7-5-3-1-2-4-6(5)8;1-2-4-6-5-3-1/h1-4,7-8H;1-6H2 |
| InChIKey | GHEHERKMOCEDDD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;cyclohexane?
The IUPAC name of benzene-1,2-diol;cyclohexane (CID 175415805) is benzene-1,2-diol;cyclohexane.
What is the SMILES notation for benzene-1,2-diol;cyclohexane?
The canonical SMILES for benzene-1,2-diol;cyclohexane is C1CCCCC1.Oc1ccccc1O.
What is the InChIKey of benzene-1,2-diol;cyclohexane?
The InChIKey is GHEHERKMOCEDDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C6H12/c7-5-3-1-2-4-6(5)8;1-2-4-6-5-3-1/h1-4,7-8H;1-6H2.
What are the key properties of benzene-1,2-diol;cyclohexane?
benzene-1,2-diol;cyclohexane has a molecular weight of 194.27 g/mol, XLogP of 3.44, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;cyclohexane is sourced from PubChem (CID 175415805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).