About benzene-1,2-diol;hydrogen peroxide
benzene-1,2-diol;hydrogen peroxide (PubChem CID 22924348) has the molecular formula C6H8O4
and a molecular weight of 144.13 g/mol. Its IUPAC name is benzene-1,2-diol;hydrogen peroxide.
Molecular Properties
| Compound Name | benzene-1,2-diol;hydrogen peroxide |
| PubChem CID | 22924348 |
| Molecular Formula | C6H8O4 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | benzene-1,2-diol;hydrogen peroxide |
| SMILES | OO.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.H2O2/c7-5-3-1-2-4-6(5)8;1-2/h1-4,7-8H;1-2H |
| InChIKey | AILCBMQLHUKUIH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;hydrogen peroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;hydrogen peroxide?
The IUPAC name of benzene-1,2-diol;hydrogen peroxide (CID 22924348) is benzene-1,2-diol;hydrogen peroxide.
What is the SMILES notation for benzene-1,2-diol;hydrogen peroxide?
The canonical SMILES for benzene-1,2-diol;hydrogen peroxide is OO.Oc1ccccc1O.
What is the InChIKey of benzene-1,2-diol;hydrogen peroxide?
The InChIKey is AILCBMQLHUKUIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.H2O2/c7-5-3-1-2-4-6(5)8;1-2/h1-4,7-8H;1-2H.
What are the key properties of benzene-1,2-diol;hydrogen peroxide?
benzene-1,2-diol;hydrogen peroxide has a molecular weight of 144.13 g/mol, XLogP of 1.12, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;hydrogen peroxide is sourced from PubChem (CID 22924348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).