About benzene-1,2-diol;methanamine
benzene-1,2-diol;methanamine (PubChem CID 159187656) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is benzene-1,2-diol;methanamine.
Molecular Properties
| Compound Name | benzene-1,2-diol;methanamine |
| PubChem CID | 159187656 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | benzene-1,2-diol;methanamine |
| SMILES | CN.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.CH5N/c7-5-3-1-2-4-6(5)8;1-2/h1-4,7-8H;2H2,1H3 |
| InChIKey | KNRQYXMAYRKDIP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;methanamine?
The IUPAC name of benzene-1,2-diol;methanamine (CID 159187656) is benzene-1,2-diol;methanamine.
What is the SMILES notation for benzene-1,2-diol;methanamine?
The canonical SMILES for benzene-1,2-diol;methanamine is CN.Oc1ccccc1O.
What is the InChIKey of benzene-1,2-diol;methanamine?
The InChIKey is KNRQYXMAYRKDIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.CH5N/c7-5-3-1-2-4-6(5)8;1-2/h1-4,7-8H;2H2,1H3.
What are the key properties of benzene-1,2-diol;methanamine?
benzene-1,2-diol;methanamine has a molecular weight of 141.17 g/mol, XLogP of 0.67, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;methanamine is sourced from PubChem (CID 159187656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).