About 3,4-difluorobenzene-1,2-diol
3,4-difluorobenzene-1,2-diol (PubChem CID 10034755) has the molecular formula C6H4F2O2
and a molecular weight of 146.09 g/mol. Its IUPAC name is 3,4-difluorobenzene-1,2-diol.
Molecular Properties
| Compound Name | 3,4-difluorobenzene-1,2-diol |
| PubChem CID | 10034755 |
| Molecular Formula | C6H4F2O2 |
| Molecular Weight | 146.09 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 3,4-difluorobenzene-1,2-diol |
| SMILES | Oc1ccc(F)c(F)c1O |
| InChI | InChI=1S/C6H4F2O2/c7-3-1-2-4(9)6(10)5(3)8/h1-2,9-10H |
| InChIKey | HLXWLHRCFGKDNS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.09 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,4-difluorobenzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-difluorobenzene-1,2-diol?
The IUPAC name of 3,4-difluorobenzene-1,2-diol (CID 10034755) is 3,4-difluorobenzene-1,2-diol.
What is the SMILES notation for 3,4-difluorobenzene-1,2-diol?
The canonical SMILES for 3,4-difluorobenzene-1,2-diol is Oc1ccc(F)c(F)c1O.
What is the InChIKey of 3,4-difluorobenzene-1,2-diol?
The InChIKey is HLXWLHRCFGKDNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2O2/c7-3-1-2-4(9)6(10)5(3)8/h1-2,9-10H.
What are the key properties of 3,4-difluorobenzene-1,2-diol?
3,4-difluorobenzene-1,2-diol has a molecular weight of 146.09 g/mol, XLogP of 1.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-difluorobenzene-1,2-diol is sourced from PubChem (CID 10034755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).