About CID 6393025
CID 6393025 (PubChem CID 6393025) has the molecular formula C6H6ClO2Sb
and a molecular weight of 267.33 g/mol.
Molecular Properties
| Compound Name | CID 6393025 |
| PubChem CID | 6393025 |
| Molecular Formula | C6H6ClO2Sb |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 265.91 |
| IUPAC Name | — |
| SMILES | Cl[Sb].Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.ClH.Sb/c7-5-3-1-2-4-6(5)8;;/h1-4,7-8H;1H;/q;;+1/p-1 |
| InChIKey | OFZOBDIDDBTWNI-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 6393025 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 6393025?
The IUPAC name of CID 6393025 (CID 6393025) is not available.
What is the SMILES notation for CID 6393025?
The canonical SMILES for CID 6393025 is Cl[Sb].Oc1ccccc1O.
What is the InChIKey of CID 6393025?
The InChIKey is OFZOBDIDDBTWNI-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6O2.ClH.Sb/c7-5-3-1-2-4-6(5)8;;/h1-4,7-8H;1H;/q;;+1/p-1.
What are the key properties of CID 6393025?
CID 6393025 has a molecular weight of 267.33 g/mol, XLogP of 1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 6393025 is sourced from PubChem (CID 6393025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).