C10H10O2 — CID 143742281
cyclodeca-2,4,6,8,10-pentaene-1,2-diol (PubChem CID 143742281) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is cyclodeca-2,4,6,8,10-pentaene-1,2-diol.
| Compound Name | cyclodeca-2,4,6,8,10-pentaene-1,2-diol |
|---|---|
| PubChem CID | 143742281 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | cyclodeca-2,4,6,8,10-pentaene-1,2-diol |
| SMILES | Oc1ccccccccc1O |
| InChI | InChI=1S/C10H10O2/c11-9-7-5-3-1-2-4-6-8-10(9)12/h1-8,11-12H/b2-1+,3-1-,4-2+,5-3-,6-4-,7-5-,8-6-,9-7-,10-8+,10-9+ |
| InChIKey | RWWCDPBQFRMRNE-XCLVAVGVSA-N |
| XLogP | 2.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |