C12H12O4 — CID 22646089
benzene-1,2-diol;benzene-1,4-diol (PubChem CID 22646089) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is benzene-1,2-diol;benzene-1,4-diol.
| Compound Name | benzene-1,2-diol;benzene-1,4-diol |
|---|---|
| PubChem CID | 22646089 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | benzene-1,2-diol;benzene-1,4-diol |
| SMILES | Oc1ccc(O)cc1.Oc1ccccc1O |
| InChI | InChI=1S/2C6H6O2/c7-5-1-2-6(8)4-3-5;7-5-3-1-2-4-6(5)8/h2*1-4,7-8H |
| InChIKey | FSHXODRICVTBJO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|