About argon;benzene-1,4-diol
argon;benzene-1,4-diol (PubChem CID 71441175) has the molecular formula C6H6ArO2
and a molecular weight of 150.06 g/mol. Its IUPAC name is argon;benzene-1,4-diol.
Molecular Properties
| Compound Name | argon;benzene-1,4-diol |
| PubChem CID | 71441175 |
| Molecular Formula | C6H6ArO2 |
| Molecular Weight | 150.06 g/mol |
| Exact Mass | 150.00 |
| IUPAC Name | argon;benzene-1,4-diol |
| SMILES | Oc1ccc(O)cc1.[Ar] |
| InChI | InChI=1S/C6H6O2.Ar/c7-5-1-2-6(8)4-3-5;/h1-4,7-8H; |
| InChIKey | IFBQWQUBSCHQNU-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.06 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze argon;benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;benzene-1,4-diol?
The IUPAC name of argon;benzene-1,4-diol (CID 71441175) is argon;benzene-1,4-diol.
What is the SMILES notation for argon;benzene-1,4-diol?
The canonical SMILES for argon;benzene-1,4-diol is Oc1ccc(O)cc1.[Ar].
What is the InChIKey of argon;benzene-1,4-diol?
The InChIKey is IFBQWQUBSCHQNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.Ar/c7-5-1-2-6(8)4-3-5;/h1-4,7-8H;.
What are the key properties of argon;benzene-1,4-diol?
argon;benzene-1,4-diol has a molecular weight of 150.06 g/mol, XLogP of 1.10, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for argon;benzene-1,4-diol is sourced from PubChem (CID 71441175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).