About bis(benzene-1,4-diol);hydroxy(oxo)phosphanium
bis(benzene-1,4-diol);hydroxy(oxo)phosphanium (PubChem CID 161269538) has the molecular formula C12H14O6P+
and a molecular weight of 285.21 g/mol. Its IUPAC name is bis(benzene-1,4-diol);hydroxy(oxo)phosphanium.
Molecular Properties
| Compound Name | bis(benzene-1,4-diol);hydroxy(oxo)phosphanium |
| PubChem CID | 161269538 |
| Molecular Formula | C12H14O6P+ |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | bis(benzene-1,4-diol);hydroxy(oxo)phosphanium |
| SMILES | O=[PH+]O.Oc1ccc(O)cc1.Oc1ccc(O)cc1 |
| InChI | InChI=1S/2C6H6O2.HO2P/c2*7-5-1-2-6(8)4-3-5;1-3-2/h2*1-4,7-8H;3H/p+1 |
| InChIKey | ROFUMYREBOYXGI-UHFFFAOYSA-O |
| XLogP | 2.11 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(benzene-1,4-diol);hydroxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(benzene-1,4-diol);hydroxy(oxo)phosphanium?
The IUPAC name of bis(benzene-1,4-diol);hydroxy(oxo)phosphanium (CID 161269538) is bis(benzene-1,4-diol);hydroxy(oxo)phosphanium.
What is the SMILES notation for bis(benzene-1,4-diol);hydroxy(oxo)phosphanium?
The canonical SMILES for bis(benzene-1,4-diol);hydroxy(oxo)phosphanium is O=[PH+]O.Oc1ccc(O)cc1.Oc1ccc(O)cc1.
What is the InChIKey of bis(benzene-1,4-diol);hydroxy(oxo)phosphanium?
The InChIKey is ROFUMYREBOYXGI-UHFFFAOYSA-O. The full InChI is InChI=1S/2C6H6O2.HO2P/c2*7-5-1-2-6(8)4-3-5;1-3-2/h2*1-4,7-8H;3H/p+1.
What are the key properties of bis(benzene-1,4-diol);hydroxy(oxo)phosphanium?
bis(benzene-1,4-diol);hydroxy(oxo)phosphanium has a molecular weight of 285.21 g/mol, XLogP of 2.11, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(benzene-1,4-diol);hydroxy(oxo)phosphanium is sourced from PubChem (CID 161269538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).