About disodium;benzene-1,4-diol;hydride
disodium;benzene-1,4-diol;hydride (PubChem CID 173178650) has the molecular formula C6H8Na2O2
and a molecular weight of 158.11 g/mol. Its IUPAC name is disodium;benzene-1,4-diol;hydride.
Molecular Properties
| Compound Name | disodium;benzene-1,4-diol;hydride |
| PubChem CID | 173178650 |
| Molecular Formula | C6H8Na2O2 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | disodium;benzene-1,4-diol;hydride |
| SMILES | Oc1ccc(O)cc1.[H-].[H-].[Na+].[Na+] |
| InChI | InChI=1S/C6H6O2.2Na.2H/c7-5-1-2-6(8)4-3-5;;;;/h1-4,7-8H;;;;/q;2*+1;2*-1 |
| InChIKey | JTHKGSAAAMDMAJ-UHFFFAOYSA-N |
| XLogP | -4.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze disodium;benzene-1,4-diol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;benzene-1,4-diol;hydride?
The IUPAC name of disodium;benzene-1,4-diol;hydride (CID 173178650) is disodium;benzene-1,4-diol;hydride.
What is the SMILES notation for disodium;benzene-1,4-diol;hydride?
The canonical SMILES for disodium;benzene-1,4-diol;hydride is Oc1ccc(O)cc1.[H-].[H-].[Na+].[Na+].
What is the InChIKey of disodium;benzene-1,4-diol;hydride?
The InChIKey is JTHKGSAAAMDMAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.2Na.2H/c7-5-1-2-6(8)4-3-5;;;;/h1-4,7-8H;;;;/q;2*+1;2*-1.
What are the key properties of disodium;benzene-1,4-diol;hydride?
disodium;benzene-1,4-diol;hydride has a molecular weight of 158.11 g/mol, XLogP of -4.67, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;benzene-1,4-diol;hydride is sourced from PubChem (CID 173178650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).