About sodium;hydride;4-methylsulfanylphenol
sodium;hydride;4-methylsulfanylphenol (PubChem CID 174371659) has the molecular formula C7H9NaOS
and a molecular weight of 164.20 g/mol. Its IUPAC name is sodium;hydride;4-methylsulfanylphenol.
Molecular Properties
| Compound Name | sodium;hydride;4-methylsulfanylphenol |
| PubChem CID | 174371659 |
| Molecular Formula | C7H9NaOS |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | sodium;hydride;4-methylsulfanylphenol |
| SMILES | CSc1ccc(O)cc1.[H-].[Na+] |
| InChI | InChI=1S/C7H8OS.Na.H/c1-9-7-4-2-6(8)3-5-7;;/h2-5,8H,1H3;;/q;+1;-1 |
| InChIKey | LXTQLBCHLPEKPV-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium;hydride;4-methylsulfanylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-methylsulfanylphenol?
The IUPAC name of sodium;hydride;4-methylsulfanylphenol (CID 174371659) is sodium;hydride;4-methylsulfanylphenol.
What is the SMILES notation for sodium;hydride;4-methylsulfanylphenol?
The canonical SMILES for sodium;hydride;4-methylsulfanylphenol is CSc1ccc(O)cc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-methylsulfanylphenol?
The InChIKey is LXTQLBCHLPEKPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS.Na.H/c1-9-7-4-2-6(8)3-5-7;;/h2-5,8H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;4-methylsulfanylphenol?
sodium;hydride;4-methylsulfanylphenol has a molecular weight of 164.20 g/mol, XLogP of -0.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-methylsulfanylphenol is sourced from PubChem (CID 174371659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).