C9H14OS2 — CID 143321779
1,4-bis(methylsulfanyl)benzene;methanol (PubChem CID 143321779) has the molecular formula C9H14OS2 and a molecular weight of 202.34 g/mol. Its IUPAC name is 1,4-bis(methylsulfanyl)benzene;methanol.
| Compound Name | 1,4-bis(methylsulfanyl)benzene;methanol |
|---|---|
| PubChem CID | 143321779 |
| Molecular Formula | C9H14OS2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 1,4-bis(methylsulfanyl)benzene;methanol |
| SMILES | CO.CSc1ccc(SC)cc1 |
| InChI | InChI=1S/C8H10S2.CH4O/c1-9-7-3-5-8(10-2)6-4-7;1-2/h3-6H,1-2H3;2H,1H3 |
| InChIKey | ASPHPUCOEPECHK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |