About 4-methylsulfanylphenol;propan-2-one
4-methylsulfanylphenol;propan-2-one (PubChem CID 158861841) has the molecular formula C10H14O2S
and a molecular weight of 198.29 g/mol. Its IUPAC name is 4-methylsulfanylphenol;propan-2-one.
Molecular Properties
| Compound Name | 4-methylsulfanylphenol;propan-2-one |
| PubChem CID | 158861841 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 4-methylsulfanylphenol;propan-2-one |
| SMILES | CC(C)=O.CSc1ccc(O)cc1 |
| InChI | InChI=1S/C7H8OS.C3H6O/c1-9-7-4-2-6(8)3-5-7;1-3(2)4/h2-5,8H,1H3;1-2H3 |
| InChIKey | JATGCSVZSOUXLP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylsulfanylphenol;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfanylphenol;propan-2-one?
The IUPAC name of 4-methylsulfanylphenol;propan-2-one (CID 158861841) is 4-methylsulfanylphenol;propan-2-one.
What is the SMILES notation for 4-methylsulfanylphenol;propan-2-one?
The canonical SMILES for 4-methylsulfanylphenol;propan-2-one is CC(C)=O.CSc1ccc(O)cc1.
What is the InChIKey of 4-methylsulfanylphenol;propan-2-one?
The InChIKey is JATGCSVZSOUXLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS.C3H6O/c1-9-7-4-2-6(8)3-5-7;1-3(2)4/h2-5,8H,1H3;1-2H3.
What are the key properties of 4-methylsulfanylphenol;propan-2-one?
4-methylsulfanylphenol;propan-2-one has a molecular weight of 198.29 g/mol, XLogP of 2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfanylphenol;propan-2-one is sourced from PubChem (CID 158861841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).