About dichlorozirconium;bis(4-methylsulfanylphenol)
dichlorozirconium;bis(4-methylsulfanylphenol) (PubChem CID 174464956) has the molecular formula C14H16Cl2O2S2Zr
and a molecular weight of 442.54 g/mol. Its IUPAC name is dichlorozirconium;bis(4-methylsulfanylphenol).
Molecular Properties
| Compound Name | dichlorozirconium;bis(4-methylsulfanylphenol) |
| PubChem CID | 174464956 |
| Molecular Formula | C14H16Cl2O2S2Zr |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 439.90 |
| IUPAC Name | dichlorozirconium;bis(4-methylsulfanylphenol) |
| SMILES | CSc1ccc(O)cc1.CSc1ccc(O)cc1.Cl[Zr]Cl |
| InChI | InChI=1S/2C7H8OS.2ClH.Zr/c2*1-9-7-4-2-6(8)3-5-7;;;/h2*2-5,8H,1H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | ABJBUKKQTRBGHE-UHFFFAOYSA-L |
| XLogP | 5.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dichlorozirconium;bis(4-methylsulfanylphenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium;bis(4-methylsulfanylphenol)?
The IUPAC name of dichlorozirconium;bis(4-methylsulfanylphenol) (CID 174464956) is dichlorozirconium;bis(4-methylsulfanylphenol).
What is the SMILES notation for dichlorozirconium;bis(4-methylsulfanylphenol)?
The canonical SMILES for dichlorozirconium;bis(4-methylsulfanylphenol) is CSc1ccc(O)cc1.CSc1ccc(O)cc1.Cl[Zr]Cl.
What is the InChIKey of dichlorozirconium;bis(4-methylsulfanylphenol)?
The InChIKey is ABJBUKKQTRBGHE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H8OS.2ClH.Zr/c2*1-9-7-4-2-6(8)3-5-7;;;/h2*2-5,8H,1H3;2*1H;/q;;;;+2/p-2.
What are the key properties of dichlorozirconium;bis(4-methylsulfanylphenol)?
dichlorozirconium;bis(4-methylsulfanylphenol) has a molecular weight of 442.54 g/mol, XLogP of 5.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium;bis(4-methylsulfanylphenol) is sourced from PubChem (CID 174464956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).