C7H7BrS — CID 76972933
1-bromo-4-methylsulfanyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (PubChem CID 76972933) has the molecular formula C7H7BrS and a molecular weight of 209.06 g/mol. Its IUPAC name is 1-bromo-4-methylsulfanyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene.
| Compound Name | 1-bromo-4-methylsulfanyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 76972933 |
| Molecular Formula | C7H7BrS |
| Molecular Weight | 209.06 g/mol |
| Exact Mass | 207.97 |
| IUPAC Name | 1-bromo-4-methylsulfanyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| SMILES | CS[13c]1[13cH][13cH][13c](Br)[13cH][13cH]1 |
| InChI | InChI=1S/C7H7BrS/c1-9-7-4-2-6(8)3-5-7/h2-5H,1H3/i2+1,3+1,4+1,5+1,6+1,7+1 |
| InChIKey | YEUYZNNBXLMFCW-WBJZHHNVSA-N |
| XLogP | 3.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.06 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |