About potassium;azanide;1-methyl-4-methylsulfanylbenzene
potassium;azanide;1-methyl-4-methylsulfanylbenzene (PubChem CID 164525020) has the molecular formula C8H12KNS
and a molecular weight of 193.36 g/mol. Its IUPAC name is potassium;azanide;1-methyl-4-methylsulfanylbenzene.
Molecular Properties
| Compound Name | potassium;azanide;1-methyl-4-methylsulfanylbenzene |
| PubChem CID | 164525020 |
| Molecular Formula | C8H12KNS |
| Molecular Weight | 193.36 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | potassium;azanide;1-methyl-4-methylsulfanylbenzene |
| SMILES | CSc1ccc(C)cc1.[K+].[NH2-] |
| InChI | InChI=1S/C8H10S.K.H2N/c1-7-3-5-8(9-2)6-4-7;;/h3-6H,1-2H3;;1H2/q;+1;-1 |
| InChIKey | SXNDXEDLUBATKL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 33.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium;azanide;1-methyl-4-methylsulfanylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;azanide;1-methyl-4-methylsulfanylbenzene?
The IUPAC name of potassium;azanide;1-methyl-4-methylsulfanylbenzene (CID 164525020) is potassium;azanide;1-methyl-4-methylsulfanylbenzene.
What is the SMILES notation for potassium;azanide;1-methyl-4-methylsulfanylbenzene?
The canonical SMILES for potassium;azanide;1-methyl-4-methylsulfanylbenzene is CSc1ccc(C)cc1.[K+].[NH2-].
What is the InChIKey of potassium;azanide;1-methyl-4-methylsulfanylbenzene?
The InChIKey is SXNDXEDLUBATKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S.K.H2N/c1-7-3-5-8(9-2)6-4-7;;/h3-6H,1-2H3;;1H2/q;+1;-1.
What are the key properties of potassium;azanide;1-methyl-4-methylsulfanylbenzene?
potassium;azanide;1-methyl-4-methylsulfanylbenzene has a molecular weight of 193.36 g/mol, XLogP of 0.44, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;azanide;1-methyl-4-methylsulfanylbenzene is sourced from PubChem (CID 164525020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).