About methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane
methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane (PubChem CID 160555586) has the molecular formula C13H26S2
and a molecular weight of 246.48 g/mol. Its IUPAC name is methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane.
Molecular Properties
| Compound Name | methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane |
| PubChem CID | 160555586 |
| Molecular Formula | C13H26S2 |
| Molecular Weight | 246.48 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane |
| SMILES | C.C.CCSC.CSc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10S.C3H8S.2CH4/c1-7-3-5-8(9-2)6-4-7;1-3-4-2;;/h3-6H,1-2H3;3H2,1-2H3;2*1H4 |
| InChIKey | QYQHGXGZPUVWJE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane?
The IUPAC name of methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane (CID 160555586) is methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane.
What is the SMILES notation for methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane?
The canonical SMILES for methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane is C.C.CCSC.CSc1ccc(C)cc1.
What is the InChIKey of methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane?
The InChIKey is QYQHGXGZPUVWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10S.C3H8S.2CH4/c1-7-3-5-8(9-2)6-4-7;1-3-4-2;;/h3-6H,1-2H3;3H2,1-2H3;2*1H4.
What are the key properties of methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane?
methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane has a molecular weight of 246.48 g/mol, XLogP of 5.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methyl-4-methylsulfanylbenzene;methylsulfanylethane is sourced from PubChem (CID 160555586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).