About 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene
1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene (PubChem CID 158033725) has the molecular formula C26H28S3
and a molecular weight of 436.71 g/mol. Its IUPAC name is 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene.
Molecular Properties
| Compound Name | 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene |
| PubChem CID | 158033725 |
| Molecular Formula | C26H28S3 |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene |
| SMILES | CSc1ccc(C)cc1.CSc1ccc2ccccc2c1.CSc1ccccc1 |
| InChI | InChI=1S/C11H10S.C8H10S.C7H8S/c1-12-11-7-6-9-4-2-3-5-10(9)8-11;1-7-3-5-8(9-2)6-4-7;1-8-7-5-3-2-4-6-7/h2-8H,1H3;3-6H,1-2H3;2-6H,1H3 |
| InChIKey | FHMKNASVCBCGAG-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene?
The IUPAC name of 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene (CID 158033725) is 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene.
What is the SMILES notation for 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene?
The canonical SMILES for 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene is CSc1ccc(C)cc1.CSc1ccc2ccccc2c1.CSc1ccccc1.
What is the InChIKey of 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene?
The InChIKey is FHMKNASVCBCGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10S.C8H10S.C7H8S/c1-12-11-7-6-9-4-2-3-5-10(9)8-11;1-7-3-5-8(9-2)6-4-7;1-8-7-5-3-2-4-6-7/h2-8H,1H3;3-6H,1-2H3;2-6H,1H3.
What are the key properties of 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene?
1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene has a molecular weight of 436.71 g/mol, XLogP of 8.69, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-methylsulfanylbenzene;methylsulfanylbenzene;2-methylsulfanylnaphthalene is sourced from PubChem (CID 158033725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).