About lithium;4-aminophenol;hydride
lithium;4-aminophenol;hydride (PubChem CID 173115053) has the molecular formula C6H8LiNO
and a molecular weight of 117.08 g/mol. Its IUPAC name is lithium;4-aminophenol;hydride.
Molecular Properties
| Compound Name | lithium;4-aminophenol;hydride |
| PubChem CID | 173115053 |
| Molecular Formula | C6H8LiNO |
| Molecular Weight | 117.08 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | lithium;4-aminophenol;hydride |
| SMILES | Nc1ccc(O)cc1.[H-].[Li+] |
| InChI | InChI=1S/C6H7NO.Li.H/c7-5-1-3-6(8)4-2-5;;/h1-4,8H,7H2;;/q;+1;-1 |
| InChIKey | RILZKWKFOSNUOD-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.08 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze lithium;4-aminophenol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;4-aminophenol;hydride?
The IUPAC name of lithium;4-aminophenol;hydride (CID 173115053) is lithium;4-aminophenol;hydride.
What is the SMILES notation for lithium;4-aminophenol;hydride?
The canonical SMILES for lithium;4-aminophenol;hydride is Nc1ccc(O)cc1.[H-].[Li+].
What is the InChIKey of lithium;4-aminophenol;hydride?
The InChIKey is RILZKWKFOSNUOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.Li.H/c7-5-1-3-6(8)4-2-5;;/h1-4,8H,7H2;;/q;+1;-1.
What are the key properties of lithium;4-aminophenol;hydride?
lithium;4-aminophenol;hydride has a molecular weight of 117.08 g/mol, XLogP of -1.91, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;4-aminophenol;hydride is sourced from PubChem (CID 173115053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).