About 4-(4-aminophenyl)aniline;phenol
4-(4-aminophenyl)aniline;phenol (PubChem CID 159428015) has the molecular formula C24H24N2O2
and a molecular weight of 372.47 g/mol. Its IUPAC name is 4-(4-aminophenyl)aniline;phenol.
Molecular Properties
| Compound Name | 4-(4-aminophenyl)aniline;phenol |
| PubChem CID | 159428015 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 4-(4-aminophenyl)aniline;phenol |
| SMILES | Nc1ccc(-c2ccc(N)cc2)cc1.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C12H12N2.2C6H6O/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;2*7-6-4-2-1-3-5-6/h1-8H,13-14H2;2*1-5,7H |
| InChIKey | LQPRZSBUWJOATF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenyl)aniline;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenyl)aniline;phenol?
The IUPAC name of 4-(4-aminophenyl)aniline;phenol (CID 159428015) is 4-(4-aminophenyl)aniline;phenol.
What is the SMILES notation for 4-(4-aminophenyl)aniline;phenol?
The canonical SMILES for 4-(4-aminophenyl)aniline;phenol is Nc1ccc(-c2ccc(N)cc2)cc1.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of 4-(4-aminophenyl)aniline;phenol?
The InChIKey is LQPRZSBUWJOATF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2.2C6H6O/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;2*7-6-4-2-1-3-5-6/h1-8H,13-14H2;2*1-5,7H.
What are the key properties of 4-(4-aminophenyl)aniline;phenol?
4-(4-aminophenyl)aniline;phenol has a molecular weight of 372.47 g/mol, XLogP of 5.30, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenyl)aniline;phenol is sourced from PubChem (CID 159428015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).