C20H22N2O — CID 155250845
4-N,4-N-dimethylbenzene-1,4-diamine;4-phenylphenol (PubChem CID 155250845) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is 4-N,4-N-dimethylbenzene-1,4-diamine;4-phenylphenol.
| Compound Name | 4-N,4-N-dimethylbenzene-1,4-diamine;4-phenylphenol |
|---|---|
| PubChem CID | 155250845 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 4-N,4-N-dimethylbenzene-1,4-diamine;4-phenylphenol |
| SMILES | CN(C)c1ccc(N)cc1.Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C8H12N2/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-10(2)8-5-3-7(9)4-6-8/h1-9,13H;3-6H,9H2,1-2H3 |
| InChIKey | XDQQGEQKDPOSTH-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|