About 4-aminophenol;butane;methanamine
4-aminophenol;butane;methanamine (PubChem CID 145479199) has the molecular formula C11H22N2O
and a molecular weight of 198.31 g/mol. Its IUPAC name is 4-aminophenol;butane;methanamine.
Molecular Properties
| Compound Name | 4-aminophenol;butane;methanamine |
| PubChem CID | 145479199 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 4-aminophenol;butane;methanamine |
| SMILES | CCCC.CN.Nc1ccc(O)cc1 |
| InChI | InChI=1S/C6H7NO.C4H10.CH5N/c7-5-1-3-6(8)4-2-5;1-3-4-2;1-2/h1-4,8H,7H2;3-4H2,1-2H3;2H2,1H3 |
| InChIKey | YVRYBXDLYHMSIY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-aminophenol;butane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminophenol;butane;methanamine?
The IUPAC name of 4-aminophenol;butane;methanamine (CID 145479199) is 4-aminophenol;butane;methanamine.
What is the SMILES notation for 4-aminophenol;butane;methanamine?
The canonical SMILES for 4-aminophenol;butane;methanamine is CCCC.CN.Nc1ccc(O)cc1.
What is the InChIKey of 4-aminophenol;butane;methanamine?
The InChIKey is YVRYBXDLYHMSIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.C4H10.CH5N/c7-5-1-3-6(8)4-2-5;1-3-4-2;1-2/h1-4,8H,7H2;3-4H2,1-2H3;2H2,1H3.
What are the key properties of 4-aminophenol;butane;methanamine?
4-aminophenol;butane;methanamine has a molecular weight of 198.31 g/mol, XLogP of 2.36, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminophenol;butane;methanamine is sourced from PubChem (CID 145479199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).