About 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol)
4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol) (PubChem CID 157077218) has the molecular formula C29H34N2O2
and a molecular weight of 442.60 g/mol. Its IUPAC name is 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol).
Molecular Properties
| Compound Name | 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol) |
| PubChem CID | 157077218 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol) |
| SMILES | CCc1ccc(O)cc1.CCc1ccc(O)cc1.Nc1ccc(Cc2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C13H14N2.2C8H10O/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;2*1-2-7-3-5-8(9)6-4-7/h1-8H,9,14-15H2;2*3-6,9H,2H2,1H3 |
| InChIKey | ADCMIPCSIPERGL-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol)?
The IUPAC name of 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol) (CID 157077218) is 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol).
What is the SMILES notation for 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol)?
The canonical SMILES for 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol) is CCc1ccc(O)cc1.CCc1ccc(O)cc1.Nc1ccc(Cc2ccc(N)cc2)cc1.
What is the InChIKey of 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol)?
The InChIKey is ADCMIPCSIPERGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2.2C8H10O/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;2*1-2-7-3-5-8(9)6-4-7/h1-8H,9,14-15H2;2*3-6,9H,2H2,1H3.
What are the key properties of 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol)?
4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol) has a molecular weight of 442.60 g/mol, XLogP of 6.35, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-aminophenyl)methyl]aniline;bis(4-ethylphenol) is sourced from PubChem (CID 157077218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).