About magnesium;4-ethylphenol;hydride
magnesium;4-ethylphenol;hydride (PubChem CID 174425334) has the molecular formula C8H12MgO
and a molecular weight of 148.49 g/mol. Its IUPAC name is magnesium;4-ethylphenol;hydride.
Molecular Properties
| Compound Name | magnesium;4-ethylphenol;hydride |
| PubChem CID | 174425334 |
| Molecular Formula | C8H12MgO |
| Molecular Weight | 148.49 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | magnesium;4-ethylphenol;hydride |
| SMILES | CCc1ccc(O)cc1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C8H10O.Mg.2H/c1-2-7-3-5-8(9)6-4-7;;;/h3-6,9H,2H2,1H3;;;/q;+2;2*-1 |
| InChIKey | UDRQWLXDMAWFRE-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.49 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze magnesium;4-ethylphenol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;4-ethylphenol;hydride?
The IUPAC name of magnesium;4-ethylphenol;hydride (CID 174425334) is magnesium;4-ethylphenol;hydride.
What is the SMILES notation for magnesium;4-ethylphenol;hydride?
The canonical SMILES for magnesium;4-ethylphenol;hydride is CCc1ccc(O)cc1.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;4-ethylphenol;hydride?
The InChIKey is UDRQWLXDMAWFRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.Mg.2H/c1-2-7-3-5-8(9)6-4-7;;;/h3-6,9H,2H2,1H3;;;/q;+2;2*-1.
What are the key properties of magnesium;4-ethylphenol;hydride?
magnesium;4-ethylphenol;hydride has a molecular weight of 148.49 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;4-ethylphenol;hydride is sourced from PubChem (CID 174425334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).