About 3-ethylphenol;4-ethylphenol
3-ethylphenol;4-ethylphenol (PubChem CID 70541430) has the molecular formula C16H20O2
and a molecular weight of 244.33 g/mol. Its IUPAC name is 3-ethylphenol;4-ethylphenol.
Molecular Properties
| Compound Name | 3-ethylphenol;4-ethylphenol |
| PubChem CID | 70541430 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 3-ethylphenol;4-ethylphenol |
| SMILES | CCc1ccc(O)cc1.CCc1cccc(O)c1 |
| InChI | InChI=1S/2C8H10O/c1-2-7-3-5-8(9)6-4-7;1-2-7-4-3-5-8(9)6-7/h2*3-6,9H,2H2,1H3 |
| InChIKey | CLBHLUQVDORXHU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethylphenol;4-ethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylphenol;4-ethylphenol?
The IUPAC name of 3-ethylphenol;4-ethylphenol (CID 70541430) is 3-ethylphenol;4-ethylphenol.
What is the SMILES notation for 3-ethylphenol;4-ethylphenol?
The canonical SMILES for 3-ethylphenol;4-ethylphenol is CCc1ccc(O)cc1.CCc1cccc(O)c1.
What is the InChIKey of 3-ethylphenol;4-ethylphenol?
The InChIKey is CLBHLUQVDORXHU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H10O/c1-2-7-3-5-8(9)6-4-7;1-2-7-4-3-5-8(9)6-7/h2*3-6,9H,2H2,1H3.
What are the key properties of 3-ethylphenol;4-ethylphenol?
3-ethylphenol;4-ethylphenol has a molecular weight of 244.33 g/mol, XLogP of 3.91, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylphenol;4-ethylphenol is sourced from PubChem (CID 70541430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).