C19H31NO — CID 143110954
(3Z)-3,4-dimethylhexa-1,3,5-triene;3-ethylphenol;N-methylethanamine (PubChem CID 143110954) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is (3Z)-3,4-dimethylhexa-1,3,5-triene;3-ethylphenol;N-methylethanamine.
| Compound Name | (3Z)-3,4-dimethylhexa-1,3,5-triene;3-ethylphenol;N-methylethanamine |
|---|---|
| PubChem CID | 143110954 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | (3Z)-3,4-dimethylhexa-1,3,5-triene;3-ethylphenol;N-methylethanamine |
| SMILES | C=C/C(C)=C(/C)C=C.CCNC.CCc1cccc(O)c1 |
| InChI | InChI=1S/C8H10O.C8H12.C3H9N/c1-2-7-4-3-5-8(9)6-7;1-5-7(3)8(4)6-2;1-3-4-2/h3-6,9H,2H2,1H3;5-6H,1-2H2,3-4H3;4H,3H2,1-2H3/b;8-7-; |
| InChIKey | LHTINRKGPGCKOZ-HXIBTQJOSA-N |
| XLogP | 4.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|