About phenol;3-propylphenol
phenol;3-propylphenol (PubChem CID 66960022) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is phenol;3-propylphenol.
Molecular Properties
| Compound Name | phenol;3-propylphenol |
| PubChem CID | 66960022 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | phenol;3-propylphenol |
| SMILES | CCCc1cccc(O)c1.Oc1ccccc1 |
| InChI | InChI=1S/C9H12O.C6H6O/c1-2-4-8-5-3-6-9(10)7-8;7-6-4-2-1-3-5-6/h3,5-7,10H,2,4H2,1H3;1-5,7H |
| InChIKey | YAOXJLMSTFYPSQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze phenol;3-propylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;3-propylphenol?
The IUPAC name of phenol;3-propylphenol (CID 66960022) is phenol;3-propylphenol.
What is the SMILES notation for phenol;3-propylphenol?
The canonical SMILES for phenol;3-propylphenol is CCCc1cccc(O)c1.Oc1ccccc1.
What is the InChIKey of phenol;3-propylphenol?
The InChIKey is YAOXJLMSTFYPSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C6H6O/c1-2-4-8-5-3-6-9(10)7-8;7-6-4-2-1-3-5-6/h3,5-7,10H,2,4H2,1H3;1-5,7H.
What are the key properties of phenol;3-propylphenol?
phenol;3-propylphenol has a molecular weight of 230.31 g/mol, XLogP of 3.74, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;3-propylphenol is sourced from PubChem (CID 66960022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).