About 1-phenyl-3-propylbenzene
1-phenyl-3-propylbenzene (PubChem CID 4110465) has the molecular formula C15H16
and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-phenyl-3-propylbenzene.
Molecular Properties
| Compound Name | 1-phenyl-3-propylbenzene |
| PubChem CID | 4110465 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 1-phenyl-3-propylbenzene |
| SMILES | CCCc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C15H16/c1-2-7-13-8-6-11-15(12-13)14-9-4-3-5-10-14/h3-6,8-12H,2,7H2,1H3 |
| InChIKey | RCUNAXHDZAPPSA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-phenyl-3-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-propylbenzene?
The IUPAC name of 1-phenyl-3-propylbenzene (CID 4110465) is 1-phenyl-3-propylbenzene.
What is the SMILES notation for 1-phenyl-3-propylbenzene?
The canonical SMILES for 1-phenyl-3-propylbenzene is CCCc1cccc(-c2ccccc2)c1.
What is the InChIKey of 1-phenyl-3-propylbenzene?
The InChIKey is RCUNAXHDZAPPSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16/c1-2-7-13-8-6-11-15(12-13)14-9-4-3-5-10-14/h3-6,8-12H,2,7H2,1H3.
What are the key properties of 1-phenyl-3-propylbenzene?
1-phenyl-3-propylbenzene has a molecular weight of 196.29 g/mol, XLogP of 4.31, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-propylbenzene is sourced from PubChem (CID 4110465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).