About 1-ethyl-3-phenylbenzene;propane
1-ethyl-3-phenylbenzene;propane (PubChem CID 145466525) has the molecular formula C17H22
and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-ethyl-3-phenylbenzene;propane.
Molecular Properties
| Compound Name | 1-ethyl-3-phenylbenzene;propane |
| PubChem CID | 145466525 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-ethyl-3-phenylbenzene;propane |
| SMILES | CCC.CCc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H14.C3H8/c1-2-12-7-6-10-14(11-12)13-8-4-3-5-9-13;1-3-2/h3-11H,2H2,1H3;3H2,1-2H3 |
| InChIKey | ZWVGLKGPBHTDDR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-ethyl-3-phenylbenzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-phenylbenzene;propane?
The IUPAC name of 1-ethyl-3-phenylbenzene;propane (CID 145466525) is 1-ethyl-3-phenylbenzene;propane.
What is the SMILES notation for 1-ethyl-3-phenylbenzene;propane?
The canonical SMILES for 1-ethyl-3-phenylbenzene;propane is CCC.CCc1cccc(-c2ccccc2)c1.
What is the InChIKey of 1-ethyl-3-phenylbenzene;propane?
The InChIKey is ZWVGLKGPBHTDDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C3H8/c1-2-12-7-6-10-14(11-12)13-8-4-3-5-9-13;1-3-2/h3-11H,2H2,1H3;3H2,1-2H3.
What are the key properties of 1-ethyl-3-phenylbenzene;propane?
1-ethyl-3-phenylbenzene;propane has a molecular weight of 226.36 g/mol, XLogP of 5.33, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-phenylbenzene;propane is sourced from PubChem (CID 145466525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).