About CID 143725407
CID 143725407 (PubChem CID 143725407) has the molecular formula C11H11
and a molecular weight of 143.21 g/mol.
Molecular Properties
| Compound Name | CID 143725407 |
| PubChem CID | 143725407 |
| Molecular Formula | C11H11 |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | — |
| SMILES | CCc1cccc(C2=C[CH]2)c1 |
| InChI | InChI=1S/C11H11/c1-2-9-4-3-5-11(8-9)10-6-7-10/h3-8H,2H2,1H3 |
| InChIKey | XKFFEVKCYCNKMD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 143725407 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 143725407?
The IUPAC name of CID 143725407 (CID 143725407) is not available.
What is the SMILES notation for CID 143725407?
The canonical SMILES for CID 143725407 is CCc1cccc(C2=C[CH]2)c1.
What is the InChIKey of CID 143725407?
The InChIKey is XKFFEVKCYCNKMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11/c1-2-9-4-3-5-11(8-9)10-6-7-10/h3-8H,2H2,1H3.
What are the key properties of CID 143725407?
CID 143725407 has a molecular weight of 143.21 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 143725407 is sourced from PubChem (CID 143725407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).