C18H22 — CID 102240202
1,4-diethyl-2-(3-ethylphenyl)benzene (PubChem CID 102240202) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 1,4-diethyl-2-(3-ethylphenyl)benzene.
| Compound Name | 1,4-diethyl-2-(3-ethylphenyl)benzene |
|---|---|
| PubChem CID | 102240202 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1,4-diethyl-2-(3-ethylphenyl)benzene |
| SMILES | CCc1cccc(-c2cc(CC)ccc2CC)c1 |
| InChI | InChI=1S/C18H22/c1-4-14-8-7-9-17(12-14)18-13-15(5-2)10-11-16(18)6-3/h7-13H,4-6H2,1-3H3 |
| InChIKey | CEYLSQRVVDSRBQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |