C16H17Cl — CID 91574528
1-(3-chlorophenyl)-2,4-diethylbenzene (PubChem CID 91574528) has the molecular formula C16H17Cl and a molecular weight of 244.76 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2,4-diethylbenzene.
| Compound Name | 1-(3-chlorophenyl)-2,4-diethylbenzene |
|---|---|
| PubChem CID | 91574528 |
| Molecular Formula | C16H17Cl |
| Molecular Weight | 244.76 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 1-(3-chlorophenyl)-2,4-diethylbenzene |
| SMILES | CCc1ccc(-c2cccc(Cl)c2)c(CC)c1 |
| InChI | InChI=1S/C16H17Cl/c1-3-12-8-9-16(13(4-2)10-12)14-6-5-7-15(17)11-14/h5-11H,3-4H2,1-2H3 |
| InChIKey | KXWFRIHMDUYXMI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.76 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |